C12H22N2O — CID 142246783
(Z,2E)-1-(dimethylamino)-2-[(E)-3-(methylamino)prop-2-enylidene]hex-3-en-1-ol (PubChem CID 142246783) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (Z,2E)-1-(dimethylamino)-2-[(E)-3-(methylamino)prop-2-enylidene]hex-3-en-1-ol.
| Compound Name | (Z,2E)-1-(dimethylamino)-2-[(E)-3-(methylamino)prop-2-enylidene]hex-3-en-1-ol |
|---|---|
| PubChem CID | 142246783 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (Z,2E)-1-(dimethylamino)-2-[(E)-3-(methylamino)prop-2-enylidene]hex-3-en-1-ol |
| SMILES | CC/C=C\C(=C/C=C/NC)C(O)N(C)C |
| InChI | InChI=1S/C12H22N2O/c1-5-6-8-11(9-7-10-13-2)12(15)14(3)4/h6-10,12-13,15H,5H2,1-4H3/b8-6-,10-7+,11-9+ |
| InChIKey | MEWVHUPRPZKMIN-YSBYEXHCSA-N |
| XLogP | 1.49 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|