C13H17ClFNO — CID 144761187
(2Z,4E)-4-[[[(1E,3Z)-3-chloro-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol (PubChem CID 144761187) has the molecular formula C13H17ClFNO and a molecular weight of 257.74 g/mol. Its IUPAC name is (2Z,4E)-4-[[[(1E,3Z)-3-chloro-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol.
| Compound Name | (2Z,4E)-4-[[[(1E,3Z)-3-chloro-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 144761187 |
| Molecular Formula | C13H17ClFNO |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (2Z,4E)-4-[[[(1E,3Z)-3-chloro-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol |
| SMILES | C=C/C(F)=C(Cl)\C=C\NCC(/C=C\CO)=C/C |
| InChI | InChI=1S/C13H17ClFNO/c1-3-11(6-5-9-17)10-16-8-7-12(14)13(15)4-2/h3-8,16-17H,2,9-10H2,1H3/b6-5-,8-7+,11-3+,13-12- |
| InChIKey | BTDLBHGOEZPKLQ-XUDOHDIPSA-N |
| XLogP | 3.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|