C15H23ClFNO — CID 144761186
(2Z,4E)-4-[[[(1E,3Z)-3-chloro-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol;ethane (PubChem CID 144761186) has the molecular formula C15H23ClFNO and a molecular weight of 287.81 g/mol. Its IUPAC name is (2Z,4E)-4-[[[(1E,3Z)-3-chloro-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol;ethane.
| Compound Name | (2Z,4E)-4-[[[(1E,3Z)-3-chloro-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol;ethane |
|---|---|
| PubChem CID | 144761186 |
| Molecular Formula | C15H23ClFNO |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2Z,4E)-4-[[[(1E,3Z)-3-chloro-4-fluorohexa-1,3,5-trienyl]amino]methyl]hexa-2,4-dien-1-ol;ethane |
| SMILES | C=C/C(F)=C(Cl)\C=C\NCC(/C=C\CO)=C/C.CC |
| InChI | InChI=1S/C13H17ClFNO.C2H6/c1-3-11(6-5-9-17)10-16-8-7-12(14)13(15)4-2;1-2/h3-8,16-17H,2,9-10H2,1H3;1-2H3/b6-5-,8-7+,11-3+,13-12-; |
| InChIKey | KNOZFYDXZNXABT-SCALLCCLSA-N |
| XLogP | 4.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|