C7H11NO — CID 139341776
3-ethyl-1,2-dihydropyridin-2-ol (PubChem CID 139341776) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 3-ethyl-1,2-dihydropyridin-2-ol.
| Compound Name | 3-ethyl-1,2-dihydropyridin-2-ol |
|---|---|
| PubChem CID | 139341776 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 3-ethyl-1,2-dihydropyridin-2-ol |
| SMILES | CCC1=CC=CNC1O |
| InChI | InChI=1S/C7H11NO/c1-2-6-4-3-5-8-7(6)9/h3-5,7-9H,2H2,1H3 |
| InChIKey | UHZNRLOGYYZVFE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |