About 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane
3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane (PubChem CID 143165667) has the molecular formula C20H25N3O2
and a molecular weight of 339.44 g/mol. Its IUPAC name is 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane.
Molecular Properties
| Compound Name | 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane |
| PubChem CID | 143165667 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane |
| SMILES | CC.Nc1ccc(C(=O)Nc2cccc(CC(O)=C3CC3)c2)cc1N |
| InChI | InChI=1S/C18H19N3O2.C2H6/c19-15-7-6-13(10-16(15)20)18(23)21-14-3-1-2-11(8-14)9-17(22)12-4-5-12;1-2/h1-3,6-8,10,22H,4-5,9,19-20H2,(H,21,23);1-2H3 |
| InChIKey | NWHNBKNCAPCMLF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane?
The IUPAC name of 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane (CID 143165667) is 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane.
What is the SMILES notation for 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane?
The canonical SMILES for 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane is CC.Nc1ccc(C(=O)Nc2cccc(CC(O)=C3CC3)c2)cc1N.
What is the InChIKey of 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane?
The InChIKey is NWHNBKNCAPCMLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O2.C2H6/c19-15-7-6-13(10-16(15)20)18(23)21-14-3-1-2-11(8-14)9-17(22)12-4-5-12;1-2/h1-3,6-8,10,22H,4-5,9,19-20H2,(H,21,23);1-2H3.
What are the key properties of 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane?
3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane has a molecular weight of 339.44 g/mol, XLogP of 4.28, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane is sourced from PubChem (CID 143165667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).