C20H25N3O2 — CID 143165667
3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane (PubChem CID 143165667) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane.
| Compound Name | 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane |
|---|---|
| PubChem CID | 143165667 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3,4-diamino-N-[3-(2-cyclopropylidene-2-hydroxyethyl)phenyl]benzamide;ethane |
| SMILES | CC.Nc1ccc(C(=O)Nc2cccc(CC(O)=C3CC3)c2)cc1N |
| InChI | InChI=1S/C18H19N3O2.C2H6/c19-15-7-6-13(10-16(15)20)18(23)21-14-3-1-2-11(8-14)9-17(22)12-4-5-12;1-2/h1-3,6-8,10,22H,4-5,9,19-20H2,(H,21,23);1-2H3 |
| InChIKey | NWHNBKNCAPCMLF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|