C28H40N8O2S2 — CID 143166691
3-methylbut-2-enyl N-[2-[[(N'-benzyl-N-methylsulfinylcarbamimidoyl)amino]methyl]-6-morpholin-4-ylpyrimidin-4-yl]-N'-but-3-en-2-ylcarbamimidothioate (PubChem CID 143166691) has the molecular formula C28H40N8O2S2 and a molecular weight of 584.82 g/mol. Its IUPAC name is 3-methylbut-2-enyl N-[2-[[(N'-benzyl-N-methylsulfinylcarbamimidoyl)amino]methyl]-6-morpholin-4-ylpyrimidin-4-yl]-N'-but-3-en-2-ylcarbamimidothioate.
| Compound Name | 3-methylbut-2-enyl N-[2-[[(N'-benzyl-N-methylsulfinylcarbamimidoyl)amino]methyl]-6-morpholin-4-ylpyrimidin-4-yl]-N'-but-3-en-2-ylcarbamimidothioate |
|---|---|
| PubChem CID | 143166691 |
| Molecular Formula | C28H40N8O2S2 |
| Molecular Weight | 584.82 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 3-methylbut-2-enyl N-[2-[[(N'-benzyl-N-methylsulfinylcarbamimidoyl)amino]methyl]-6-morpholin-4-ylpyrimidin-4-yl]-N'-but-3-en-2-ylcarbamimidothioate |
| SMILES | C=CC(C)/N=C(/Nc1cc(N2CCOCC2)nc(CN/C(=N/Cc2ccccc2)NS(C)=O)n1)SCC=C(C)C |
| InChI | InChI=1S/C28H40N8O2S2/c1-6-22(4)31-28(39-17-12-21(2)3)34-24-18-26(36-13-15-38-16-14-36)33-25(32-24)20-30-27(35-40(5)37)29-19-23-10-8-7-9-11-23/h6-12,18,22H,1,13-17,19-20H2,2-5H3,(H2,29,30,35)(H,31,32,33,34) |
| InChIKey | XXMJDNXGEBXPJG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.82 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|