C31H41N7O2 — CID 143166665
N-[[4-[(2E)-2-(2,3-dihydroinden-1-ylidene)hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]methyl]-2-[[(2E,5Z)-octa-2,5,7-trien-3-yl]amino]prop-2-enamide;ethane (PubChem CID 143166665) has the molecular formula C31H41N7O2 and a molecular weight of 543.72 g/mol. Its IUPAC name is N-[[4-[(2E)-2-(2,3-dihydroinden-1-ylidene)hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]methyl]-2-[[(2E,5Z)-octa-2,5,7-trien-3-yl]amino]prop-2-enamide;ethane.
| Compound Name | N-[[4-[(2E)-2-(2,3-dihydroinden-1-ylidene)hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]methyl]-2-[[(2E,5Z)-octa-2,5,7-trien-3-yl]amino]prop-2-enamide;ethane |
|---|---|
| PubChem CID | 143166665 |
| Molecular Formula | C31H41N7O2 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | N-[[4-[(2E)-2-(2,3-dihydroinden-1-ylidene)hydrazinyl]-6-morpholin-4-ylpyrimidin-2-yl]methyl]-2-[[(2E,5Z)-octa-2,5,7-trien-3-yl]amino]prop-2-enamide;ethane |
| SMILES | C=C/C=C\C/C(=C\C)NC(=C)C(=O)NCc1nc(N/N=C2\CCc3ccccc32)cc(N2CCOCC2)n1.CC |
| InChI | InChI=1S/C29H35N7O2.C2H6/c1-4-6-7-11-23(5-2)31-21(3)29(37)30-20-27-32-26(19-28(33-27)36-15-17-38-18-16-36)35-34-25-14-13-22-10-8-9-12-24(22)25;1-2/h4-10,12,19,31H,1,3,11,13-18,20H2,2H3,(H,30,37)(H,32,33,35);1-2H3/b7-6-,23-5+,34-25+; |
| InChIKey | NCUIUZPKOVNIOS-FIBIIBBCSA-N |
| XLogP | 4.86 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|