C20H23N3O6S — CID 143170419
2-[4-[[(4-cyanophenyl)methyl-methylsulfonylamino]methyl]anilino]-2-oxoacetic acid;methoxymethane (PubChem CID 143170419) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is 2-[4-[[(4-cyanophenyl)methyl-methylsulfonylamino]methyl]anilino]-2-oxoacetic acid;methoxymethane.
| Compound Name | 2-[4-[[(4-cyanophenyl)methyl-methylsulfonylamino]methyl]anilino]-2-oxoacetic acid;methoxymethane |
|---|---|
| PubChem CID | 143170419 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[4-[[(4-cyanophenyl)methyl-methylsulfonylamino]methyl]anilino]-2-oxoacetic acid;methoxymethane |
| SMILES | COC.CS(=O)(=O)N(Cc1ccc(C#N)cc1)Cc1ccc(NC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H17N3O5S.C2H6O/c1-27(25,26)21(11-14-4-2-13(10-19)3-5-14)12-15-6-8-16(9-7-15)20-17(22)18(23)24;1-3-2/h2-9H,11-12H2,1H3,(H,20,22)(H,23,24);1-2H3 |
| InChIKey | VWIVJPNOMUZGHE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|