C18H17N3O5S — CID 143170420
2-[4-[[(4-cyanophenyl)methyl-methylsulfonylamino]methyl]anilino]-2-oxoacetic acid (PubChem CID 143170420) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-[4-[[(4-cyanophenyl)methyl-methylsulfonylamino]methyl]anilino]-2-oxoacetic acid.
| Compound Name | 2-[4-[[(4-cyanophenyl)methyl-methylsulfonylamino]methyl]anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 143170420 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-[4-[[(4-cyanophenyl)methyl-methylsulfonylamino]methyl]anilino]-2-oxoacetic acid |
| SMILES | CS(=O)(=O)N(Cc1ccc(C#N)cc1)Cc1ccc(NC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H17N3O5S/c1-27(25,26)21(11-14-4-2-13(10-19)3-5-14)12-15-6-8-16(9-7-15)20-17(22)18(23)24/h2-9H,11-12H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | IEQUQJPKUBGUMC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|