ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid

C17H20O3 — CID 143170449

IUPACethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid
SMILESCC.Cc1ccc(-c2ccc(CO)c(C(=O)O)c2)cc1
InChIInChI=1S/C15H14O3.C2H6/c1-10-2-4-11(5-3-10)12-6-7-13(9-16)14(8-12)15(17)18;1-2/h2-8,16H,9H2,1H3,(H,17,18);1-2H3
InChIKeyOABBTVUGHYQMHT-UHFFFAOYSA-N
MW272.34 g/mol
LogP3.88
Rot. Bonds3

About ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid

ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid (PubChem CID 143170449) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid.

Molecular Properties

Compound Nameethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid
PubChem CID143170449
Molecular FormulaC17H20O3
Molecular Weight272.34 g/mol
Exact Mass272.14
IUPAC Nameethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid
SMILESCC.Cc1ccc(-c2ccc(CO)c(C(=O)O)c2)cc1
InChIInChI=1S/C15H14O3.C2H6/c1-10-2-4-11(5-3-10)12-6-7-13(9-16)14(8-12)15(17)18;1-2/h2-8,16H,9H2,1H3,(H,17,18);1-2H3
InChIKeyOABBTVUGHYQMHT-UHFFFAOYSA-N
XLogP3.88
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.34
LogP ≤ 53.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid?
The IUPAC name of ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid (CID 143170449) is ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid.
What is the SMILES notation for ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid?
The canonical SMILES for ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid is CC.Cc1ccc(-c2ccc(CO)c(C(=O)O)c2)cc1.
What is the InChIKey of ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid?
The InChIKey is OABBTVUGHYQMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3.C2H6/c1-10-2-4-11(5-3-10)12-6-7-13(9-16)14(8-12)15(17)18;1-2/h2-8,16H,9H2,1H3,(H,17,18);1-2H3.
What are the key properties of ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid?
ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid has a molecular weight of 272.34 g/mol, XLogP of 3.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(hydroxymethyl)-5-(4-methylphenyl)benzoic acid is sourced from PubChem (CID 143170449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).