C22H31N — CID 143173592
N-methyl-N-[2-(2-methyl-6-propylphenyl)ethyl]-3-phenylpropan-1-amine (PubChem CID 143173592) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is N-methyl-N-[2-(2-methyl-6-propylphenyl)ethyl]-3-phenylpropan-1-amine.
| Compound Name | N-methyl-N-[2-(2-methyl-6-propylphenyl)ethyl]-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 143173592 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | N-methyl-N-[2-(2-methyl-6-propylphenyl)ethyl]-3-phenylpropan-1-amine |
| SMILES | CCCc1cccc(C)c1CCN(C)CCCc1ccccc1 |
| InChI | InChI=1S/C22H31N/c1-4-10-21-15-8-11-19(2)22(21)16-18-23(3)17-9-14-20-12-6-5-7-13-20/h5-8,11-13,15H,4,9-10,14,16-18H2,1-3H3 |
| InChIKey | WVSJYCOTPKMFAB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |