C20H25NOS — CID 143174148
N-[(4Z)-4-ethenyl-2-methylhepta-4,6-dien-2-yl]-1-phenylsulfanylcyclopropane-1-carboxamide (PubChem CID 143174148) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is N-[(4Z)-4-ethenyl-2-methylhepta-4,6-dien-2-yl]-1-phenylsulfanylcyclopropane-1-carboxamide.
| Compound Name | N-[(4Z)-4-ethenyl-2-methylhepta-4,6-dien-2-yl]-1-phenylsulfanylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143174148 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[(4Z)-4-ethenyl-2-methylhepta-4,6-dien-2-yl]-1-phenylsulfanylcyclopropane-1-carboxamide |
| SMILES | C=C/C=C(\C=C)CC(C)(C)NC(=O)C1(Sc2ccccc2)CC1 |
| InChI | InChI=1S/C20H25NOS/c1-5-10-16(6-2)15-19(3,4)21-18(22)20(13-14-20)23-17-11-8-7-9-12-17/h5-12H,1-2,13-15H2,3-4H3,(H,21,22)/b16-10+ |
| InChIKey | RIMTYSSLZCZTLQ-MHWRWJLKSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|