C35H41FN2O2 — CID 143174379
(6,9-diethylcarbazol-3-yl)methanol;(9-ethyl-6-fluorocarbazol-3-yl)methanol;propane (PubChem CID 143174379) has the molecular formula C35H41FN2O2 and a molecular weight of 540.72 g/mol. Its IUPAC name is (6,9-diethylcarbazol-3-yl)methanol;(9-ethyl-6-fluorocarbazol-3-yl)methanol;propane.
| Compound Name | (6,9-diethylcarbazol-3-yl)methanol;(9-ethyl-6-fluorocarbazol-3-yl)methanol;propane |
|---|---|
| PubChem CID | 143174379 |
| Molecular Formula | C35H41FN2O2 |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | (6,9-diethylcarbazol-3-yl)methanol;(9-ethyl-6-fluorocarbazol-3-yl)methanol;propane |
| SMILES | CCC.CCc1ccc2c(c1)c1cc(CO)ccc1n2CC.CCn1c2ccc(F)cc2c2cc(CO)ccc21 |
| InChI | InChI=1S/C17H19NO.C15H14FNO.C3H8/c1-3-12-5-7-16-14(9-12)15-10-13(11-19)6-8-17(15)18(16)4-2;1-2-17-14-5-3-10(9-18)7-12(14)13-8-11(16)4-6-15(13)17;1-3-2/h5-10,19H,3-4,11H2,1-2H3;3-8,18H,2,9H2,1H3;3H2,1-2H3 |
| InChIKey | DUNLUYHUAXGJIM-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |