C26H30F3N3O — CID 143174829
2-propan-2-yl-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]-6-(3,4,5-trifluorophenyl)quinazolin-4-one (PubChem CID 143174829) has the molecular formula C26H30F3N3O and a molecular weight of 457.54 g/mol. Its IUPAC name is 2-propan-2-yl-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]-6-(3,4,5-trifluorophenyl)quinazolin-4-one.
| Compound Name | 2-propan-2-yl-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]-6-(3,4,5-trifluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 143174829 |
| Molecular Formula | C26H30F3N3O |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 2-propan-2-yl-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]-6-(3,4,5-trifluorophenyl)quinazolin-4-one |
| SMILES | CC(C)c1nc2ccc(-c3cc(F)c(F)c(F)c3)cc2c(=O)n1C[C@H]1CCCN(C(C)C)C1 |
| InChI | InChI=1S/C26H30F3N3O/c1-15(2)25-30-23-8-7-18(19-11-21(27)24(29)22(28)12-19)10-20(23)26(33)32(25)14-17-6-5-9-31(13-17)16(3)4/h7-8,10-12,15-17H,5-6,9,13-14H2,1-4H3/t17-/m0/s1 |
| InChIKey | MBOLWVCKIHSIIH-KRWDZBQOSA-N |
| XLogP | 5.72 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|