C25H30FN3O — CID 143175024
2-ethyl-6-(2-fluorophenyl)-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]quinazolin-4-one (PubChem CID 143175024) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is 2-ethyl-6-(2-fluorophenyl)-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]quinazolin-4-one.
| Compound Name | 2-ethyl-6-(2-fluorophenyl)-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 143175024 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 2-ethyl-6-(2-fluorophenyl)-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]quinazolin-4-one |
| SMILES | CCc1nc2ccc(-c3ccccc3F)cc2c(=O)n1C[C@H]1CCCN(C(C)C)C1 |
| InChI | InChI=1S/C25H30FN3O/c1-4-24-27-23-12-11-19(20-9-5-6-10-22(20)26)14-21(23)25(30)29(24)16-18-8-7-13-28(15-18)17(2)3/h5-6,9-12,14,17-18H,4,7-8,13,15-16H2,1-3H3/t18-/m0/s1 |
| InChIKey | UOJHXPWYTHOBBR-SFHVURJKSA-N |
| XLogP | 4.89 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |