C24H28ClN3O — CID 143175381
6-(4-chlorophenyl)-2-ethyl-3-[[(3S)-1-ethylpiperidin-3-yl]methyl]quinazolin-4-one (PubChem CID 143175381) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-ethyl-3-[[(3S)-1-ethylpiperidin-3-yl]methyl]quinazolin-4-one.
| Compound Name | 6-(4-chlorophenyl)-2-ethyl-3-[[(3S)-1-ethylpiperidin-3-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 143175381 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 6-(4-chlorophenyl)-2-ethyl-3-[[(3S)-1-ethylpiperidin-3-yl]methyl]quinazolin-4-one |
| SMILES | CCc1nc2ccc(-c3ccc(Cl)cc3)cc2c(=O)n1C[C@H]1CCCN(CC)C1 |
| InChI | InChI=1S/C24H28ClN3O/c1-3-23-26-22-12-9-19(18-7-10-20(25)11-8-18)14-21(22)24(29)28(23)16-17-6-5-13-27(4-2)15-17/h7-12,14,17H,3-6,13,15-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | FPUWRRYFFHWCDE-KRWDZBQOSA-N |
| XLogP | 5.01 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |