C13H18N2O — CID 143175089
2,3-dimethyl-7H-cyclohepta[d]pyrimidin-4-one;ethane (PubChem CID 143175089) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2,3-dimethyl-7H-cyclohepta[d]pyrimidin-4-one;ethane.
| Compound Name | 2,3-dimethyl-7H-cyclohepta[d]pyrimidin-4-one;ethane |
|---|---|
| PubChem CID | 143175089 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2,3-dimethyl-7H-cyclohepta[d]pyrimidin-4-one;ethane |
| SMILES | CC.Cc1nc2c(c(=O)n1C)C=CCC=C2 |
| InChI | InChI=1S/C11H12N2O.C2H6/c1-8-12-10-7-5-3-4-6-9(10)11(14)13(8)2;1-2/h4-7H,3H2,1-2H3;1-2H3 |
| InChIKey | DIRJBXPHXOIOAY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |