C17H21BrO — CID 143179118
2-bromo-2-cycloheptyl-1-(cyclooctatetraenyl)ethanone (PubChem CID 143179118) has the molecular formula C17H21BrO and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-bromo-2-cycloheptyl-1-(cyclooctatetraenyl)ethanone.
| Compound Name | 2-bromo-2-cycloheptyl-1-(cyclooctatetraenyl)ethanone |
|---|---|
| PubChem CID | 143179118 |
| Molecular Formula | C17H21BrO |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-bromo-2-cycloheptyl-1-(cyclooctatetraenyl)ethanone |
| SMILES | O=C(C1=C/C=C\C=C/C=C\1)C(Br)C1CCCCCC1 |
| InChI | InChI=1S/C17H21BrO/c18-16(14-10-6-4-5-7-11-14)17(19)15-12-8-2-1-3-9-13-15/h1-3,8-9,12-14,16H,4-7,10-11H2/b2-1-,3-1-,8-2-,9-3-,12-8-,13-9-,15-12+,15-13+ |
| InChIKey | JEEMRIXGGUFQCJ-CJLQWKEMSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|