C25H25N8S+ — CID 143181307
[2-amino-5-[[6-[1-(phenylcarbamothioyl)-3,6-dihydro-2H-pyridin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium (PubChem CID 143181307) has the molecular formula C25H25N8S+ and a molecular weight of 469.60 g/mol. Its IUPAC name is [2-amino-5-[[6-[1-(phenylcarbamothioyl)-3,6-dihydro-2H-pyridin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium.
| Compound Name | [2-amino-5-[[6-[1-(phenylcarbamothioyl)-3,6-dihydro-2H-pyridin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium |
|---|---|
| PubChem CID | 143181307 |
| Molecular Formula | C25H25N8S+ |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | [2-amino-5-[[6-[1-(phenylcarbamothioyl)-3,6-dihydro-2H-pyridin-4-yl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]phenyl]methylideneazanium |
| SMILES | Nc1ccc(Nc2ncnc3[nH]c(C4=CCN(C(=S)Nc5ccccc5)CC4)cc23)cc1C=[NH2+] |
| InChI | InChI=1S/C25H24N8S/c26-14-17-12-19(6-7-21(17)27)30-23-20-13-22(32-24(20)29-15-28-23)16-8-10-33(11-9-16)25(34)31-18-4-2-1-3-5-18/h1-8,12-15,26H,9-11,27H2,(H,31,34)(H2,28,29,30,32)/p+1 |
| InChIKey | ORUYNQYQZQXEBQ-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|