C26H23N7S — CID 16734808
4-[4-(1H-indazol-5-ylamino)-1H-pyrrolo[2,3-b]pyridin-2-yl]-N-phenyl-3,6-dihydro-2H-pyridine-1-carbothioamide (PubChem CID 16734808) has the molecular formula C26H23N7S and a molecular weight of 465.59 g/mol. Its IUPAC name is 4-[4-(1H-indazol-5-ylamino)-1H-pyrrolo[2,3-b]pyridin-2-yl]-N-phenyl-3,6-dihydro-2H-pyridine-1-carbothioamide.
| Compound Name | 4-[4-(1H-indazol-5-ylamino)-1H-pyrrolo[2,3-b]pyridin-2-yl]-N-phenyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 16734808 |
| Molecular Formula | C26H23N7S |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 4-[4-(1H-indazol-5-ylamino)-1H-pyrrolo[2,3-b]pyridin-2-yl]-N-phenyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1CC=C(c2cc3c(Nc4ccc5[nH]ncc5c4)ccnc3[nH]2)CC1 |
| InChI | InChI=1S/C26H23N7S/c34-26(30-19-4-2-1-3-5-19)33-12-9-17(10-13-33)24-15-21-23(8-11-27-25(21)31-24)29-20-6-7-22-18(14-20)16-28-32-22/h1-9,11,14-16H,10,12-13H2,(H,28,32)(H,30,34)(H2,27,29,31) |
| InChIKey | MOUBVEVZTFGKEE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|