C28H44N4O2 — CID 143182217
N-[4-[[(1R)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]phenyl]-4-(cyclohexylmethyl)piperazine-1-carboxamide (PubChem CID 143182217) has the molecular formula C28H44N4O2 and a molecular weight of 468.69 g/mol. Its IUPAC name is N-[4-[[(1R)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]phenyl]-4-(cyclohexylmethyl)piperazine-1-carboxamide.
| Compound Name | N-[4-[[(1R)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]phenyl]-4-(cyclohexylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 143182217 |
| Molecular Formula | C28H44N4O2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.35 |
| IUPAC Name | N-[4-[[(1R)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]phenyl]-4-(cyclohexylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC[C@@H]2CCCN3CCCCC23)cc1)N1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C28H44N4O2/c33-28(32-19-17-30(18-20-32)21-23-7-2-1-3-8-23)29-25-11-13-26(14-12-25)34-22-24-9-6-16-31-15-5-4-10-27(24)31/h11-14,23-24,27H,1-10,15-22H2,(H,29,33)/t24-,27?/m0/s1 |
| InChIKey | BWLHLODGURNDSZ-BXXZMZEQSA-N |
| XLogP | 5.06 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |