C14H19N3O2 — CID 143182262
7-(4-aminophenyl)-2,7-diazaspiro[4.4]nonane-2-carboxylic acid (PubChem CID 143182262) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 7-(4-aminophenyl)-2,7-diazaspiro[4.4]nonane-2-carboxylic acid.
| Compound Name | 7-(4-aminophenyl)-2,7-diazaspiro[4.4]nonane-2-carboxylic acid |
|---|---|
| PubChem CID | 143182262 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 7-(4-aminophenyl)-2,7-diazaspiro[4.4]nonane-2-carboxylic acid |
| SMILES | Nc1ccc(N2CCC3(CCN(C(=O)O)C3)C2)cc1 |
| InChI | InChI=1S/C14H19N3O2/c15-11-1-3-12(4-2-11)16-7-5-14(9-16)6-8-17(10-14)13(18)19/h1-4H,5-10,15H2,(H,18,19) |
| InChIKey | LGZBLGAUWSHYSL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|