C24H24N2O2 — CID 3232660
furan-2-yl-[2-(4-phenylphenyl)-2,7-diazaspiro[3.5]nonan-7-yl]methanone (PubChem CID 3232660) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is furan-2-yl-[2-(4-phenylphenyl)-2,7-diazaspiro[3.5]nonan-7-yl]methanone.
| Compound Name | furan-2-yl-[2-(4-phenylphenyl)-2,7-diazaspiro[3.5]nonan-7-yl]methanone |
|---|---|
| PubChem CID | 3232660 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | furan-2-yl-[2-(4-phenylphenyl)-2,7-diazaspiro[3.5]nonan-7-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCC2(CC1)CN(c1ccc(-c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C24H24N2O2/c27-23(22-7-4-16-28-22)25-14-12-24(13-15-25)17-26(18-24)21-10-8-20(9-11-21)19-5-2-1-3-6-19/h1-11,16H,12-15,17-18H2 |
| InChIKey | OODCRTMCPAPUAI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |