C17H24N2 — CID 143182372
4-(6,7-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-N-ethynylbutan-1-amine (PubChem CID 143182372) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-(6,7-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-N-ethynylbutan-1-amine.
| Compound Name | 4-(6,7-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-N-ethynylbutan-1-amine |
|---|---|
| PubChem CID | 143182372 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-(6,7-dimethyl-3,4-dihydro-1H-isoquinolin-2-yl)-N-ethynylbutan-1-amine |
| SMILES | C#CNCCCCN1CCc2cc(C)c(C)cc2C1 |
| InChI | InChI=1S/C17H24N2/c1-4-18-8-5-6-9-19-10-7-16-11-14(2)15(3)12-17(16)13-19/h1,11-12,18H,5-10,13H2,2-3H3 |
| InChIKey | KUDBZTNJOORCKI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|