C8H11NO2 — CID 143182657
3-methoxy-4-(methylamino)cyclohexa-2,5-dien-1-one (PubChem CID 143182657) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-methoxy-4-(methylamino)cyclohexa-2,5-dien-1-one.
| Compound Name | 3-methoxy-4-(methylamino)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 143182657 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 3-methoxy-4-(methylamino)cyclohexa-2,5-dien-1-one |
| SMILES | CNC1C=CC(=O)C=C1OC |
| InChI | InChI=1S/C8H11NO2/c1-9-7-4-3-6(10)5-8(7)11-2/h3-5,7,9H,1-2H3 |
| InChIKey | AUGJUFGTYIZPBS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |