C7H8NO2- — CID 143182814
(2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)azanide (PubChem CID 143182814) has the molecular formula C7H8NO2- and a molecular weight of 138.15 g/mol. Its IUPAC name is (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)azanide.
| Compound Name | (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)azanide |
|---|---|
| PubChem CID | 143182814 |
| Molecular Formula | C7H8NO2- |
| Molecular Weight | 138.15 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)azanide |
| SMILES | COC1=CC(=O)C=CC1[NH-] |
| InChI | InChI=1S/C7H8NO2/c1-10-7-4-5(9)2-3-6(7)8/h2-4,6,8H,1H3/q-1 |
| InChIKey | SSNPDGBKZBXTNC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 50.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.15 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |