C9H9ClN2O — CID 143183196
2-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]propanenitrile (PubChem CID 143183196) has the molecular formula C9H9ClN2O and a molecular weight of 196.64 g/mol. Its IUPAC name is 2-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]propanenitrile.
| Compound Name | 2-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]propanenitrile |
|---|---|
| PubChem CID | 143183196 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]propanenitrile |
| SMILES | CC(C#N)c1ncc(CO)cc1Cl |
| InChI | InChI=1S/C9H9ClN2O/c1-6(3-11)9-8(10)2-7(5-13)4-12-9/h2,4,6,13H,5H2,1H3 |
| InChIKey | TYVHXVWDLVMLMP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |