C19H18FN — CID 143183515
4-[cyclopropyl-(4-fluorophenyl)methyl]-3-ethylbenzonitrile (PubChem CID 143183515) has the molecular formula C19H18FN and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-[cyclopropyl-(4-fluorophenyl)methyl]-3-ethylbenzonitrile.
| Compound Name | 4-[cyclopropyl-(4-fluorophenyl)methyl]-3-ethylbenzonitrile |
|---|---|
| PubChem CID | 143183515 |
| Molecular Formula | C19H18FN |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-[cyclopropyl-(4-fluorophenyl)methyl]-3-ethylbenzonitrile |
| SMILES | CCc1cc(C#N)ccc1C(c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C19H18FN/c1-2-14-11-13(12-21)3-10-18(14)19(15-4-5-15)16-6-8-17(20)9-7-16/h3,6-11,15,19H,2,4-5H2,1H3 |
| InChIKey | JUMUFAANLDQDGO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |