C13H16O4 — CID 143183685
2-[(4-methyl-2-oxopentoxy)methyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 143183685) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[(4-methyl-2-oxopentoxy)methyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(4-methyl-2-oxopentoxy)methyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 143183685 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-[(4-methyl-2-oxopentoxy)methyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)CC(=O)COCC1=CC(=O)C=CC1=O |
| InChI | InChI=1S/C13H16O4/c1-9(2)5-12(15)8-17-7-10-6-11(14)3-4-13(10)16/h3-4,6,9H,5,7-8H2,1-2H3 |
| InChIKey | QIAATPNKFJZPDH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|