C9H8O3 — CID 101146423
1-oxaspiro[4.5]deca-6,9-diene-3,8-dione (PubChem CID 101146423) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1-oxaspiro[4.5]deca-6,9-diene-3,8-dione.
| Compound Name | 1-oxaspiro[4.5]deca-6,9-diene-3,8-dione |
|---|---|
| PubChem CID | 101146423 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 1-oxaspiro[4.5]deca-6,9-diene-3,8-dione |
| SMILES | O=C1C=CC2(C=C1)CC(=O)CO2 |
| InChI | InChI=1S/C9H8O3/c10-7-1-3-9(4-2-7)5-8(11)6-12-9/h1-4H,5-6H2 |
| InChIKey | UTUNGEQXHLEXTF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |