C6H6O2 — CID 14566518
(1R,5R)-5-methyl-6-oxabicyclo[3.1.0]hex-3-en-2-one (PubChem CID 14566518) has the molecular formula C6H6O2 and a molecular weight of 110.11 g/mol. Its IUPAC name is (1R,5R)-5-methyl-6-oxabicyclo[3.1.0]hex-3-en-2-one.
| Compound Name | (1R,5R)-5-methyl-6-oxabicyclo[3.1.0]hex-3-en-2-one |
|---|---|
| PubChem CID | 14566518 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 110.11 g/mol |
| Exact Mass | 110.04 |
| IUPAC Name | (1R,5R)-5-methyl-6-oxabicyclo[3.1.0]hex-3-en-2-one |
| SMILES | C[C@@]12C=CC(=O)[C@@H]1O2 |
| InChI | InChI=1S/C6H6O2/c1-6-3-2-4(7)5(6)8-6/h2-3,5H,1H3/t5-,6+/m0/s1 |
| InChIKey | WRABBHOIGFTUBW-NTSWFWBYSA-N |
| XLogP | 0.28 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.11 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|