C7H8O2 — CID 10374460
(1S,5S)-1,3-dimethyl-6-oxabicyclo[3.1.0]hex-3-en-2-one (PubChem CID 10374460) has the molecular formula C7H8O2 and a molecular weight of 124.14 g/mol. Its IUPAC name is (1S,5S)-1,3-dimethyl-6-oxabicyclo[3.1.0]hex-3-en-2-one.
| Compound Name | (1S,5S)-1,3-dimethyl-6-oxabicyclo[3.1.0]hex-3-en-2-one |
|---|---|
| PubChem CID | 10374460 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | (1S,5S)-1,3-dimethyl-6-oxabicyclo[3.1.0]hex-3-en-2-one |
| SMILES | CC1=C[C@@H]2O[C@]2(C)C1=O |
| InChI | InChI=1S/C7H8O2/c1-4-3-5-7(2,9-5)6(4)8/h3,5H,1-2H3/t5-,7-/m0/s1 |
| InChIKey | ZFKWOWPFPXKRDV-FSPLSTOPSA-N |
| XLogP | 0.67 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|