C8H10O3 — CID 14566500
(1R,5R)-1-(ethoxymethyl)-6-oxabicyclo[3.1.0]hex-3-en-2-one (PubChem CID 14566500) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (1R,5R)-1-(ethoxymethyl)-6-oxabicyclo[3.1.0]hex-3-en-2-one.
| Compound Name | (1R,5R)-1-(ethoxymethyl)-6-oxabicyclo[3.1.0]hex-3-en-2-one |
|---|---|
| PubChem CID | 14566500 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1R,5R)-1-(ethoxymethyl)-6-oxabicyclo[3.1.0]hex-3-en-2-one |
| SMILES | CCOC[C@@]12O[C@@H]1C=CC2=O |
| InChI | InChI=1S/C8H10O3/c1-2-10-5-8-6(9)3-4-7(8)11-8/h3-4,7H,2,5H2,1H3/t7-,8+/m1/s1 |
| InChIKey | NABWKNIQXPUQOO-SFYZADRCSA-N |
| XLogP | 0.30 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|