C10H12O3 — CID 102571161
7-methoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 102571161) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 7-methoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one.
| Compound Name | 7-methoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| PubChem CID | 102571161 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 7-methoxy-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | COC1=CC2(C=CC1=O)CCCO2 |
| InChI | InChI=1S/C10H12O3/c1-12-9-7-10(4-2-6-13-10)5-3-8(9)11/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | AJMYHEKUGJYTQW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |