C19H23N3O2 — CID 143184285
N'-methoxy-N-[4-(6-methoxy-1H-indol-2-yl)phenyl]propane-1,3-diamine (PubChem CID 143184285) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N'-methoxy-N-[4-(6-methoxy-1H-indol-2-yl)phenyl]propane-1,3-diamine.
| Compound Name | N'-methoxy-N-[4-(6-methoxy-1H-indol-2-yl)phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143184285 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N'-methoxy-N-[4-(6-methoxy-1H-indol-2-yl)phenyl]propane-1,3-diamine |
| SMILES | CONCCCNc1ccc(-c2cc3ccc(OC)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H23N3O2/c1-23-17-9-6-15-12-18(22-19(15)13-17)14-4-7-16(8-5-14)20-10-3-11-21-24-2/h4-9,12-13,20-22H,3,10-11H2,1-2H3 |
| InChIKey | WXDSXIPALODEKM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|