C24H24F2N4O2 — CID 143184446
1-[4-[3-cyano-1-(2-cyclopropylethyl)-6-(difluoromethoxy)indol-2-yl]phenyl]-3-ethylurea (PubChem CID 143184446) has the molecular formula C24H24F2N4O2 and a molecular weight of 438.48 g/mol. Its IUPAC name is 1-[4-[3-cyano-1-(2-cyclopropylethyl)-6-(difluoromethoxy)indol-2-yl]phenyl]-3-ethylurea.
| Compound Name | 1-[4-[3-cyano-1-(2-cyclopropylethyl)-6-(difluoromethoxy)indol-2-yl]phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 143184446 |
| Molecular Formula | C24H24F2N4O2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-[4-[3-cyano-1-(2-cyclopropylethyl)-6-(difluoromethoxy)indol-2-yl]phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(-c2c(C#N)c3ccc(OC(F)F)cc3n2CCC2CC2)cc1 |
| InChI | InChI=1S/C24H24F2N4O2/c1-2-28-24(31)29-17-7-5-16(6-8-17)22-20(14-27)19-10-9-18(32-23(25)26)13-21(19)30(22)12-11-15-3-4-15/h5-10,13,15,23H,2-4,11-12H2,1H3,(H2,28,29,31) |
| InChIKey | XSZAJBVGBODZJO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |