C24H27N3O2 — CID 143184504
(Z)-2-[7-(ethylamino)-5-(2-oxoethyl)cyclohepta-1,4,6-trien-1-yl]-5-(3-methoxyphenyl)pent-2-en-4-ynenitrile;methanamine (PubChem CID 143184504) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is (Z)-2-[7-(ethylamino)-5-(2-oxoethyl)cyclohepta-1,4,6-trien-1-yl]-5-(3-methoxyphenyl)pent-2-en-4-ynenitrile;methanamine.
| Compound Name | (Z)-2-[7-(ethylamino)-5-(2-oxoethyl)cyclohepta-1,4,6-trien-1-yl]-5-(3-methoxyphenyl)pent-2-en-4-ynenitrile;methanamine |
|---|---|
| PubChem CID | 143184504 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | (Z)-2-[7-(ethylamino)-5-(2-oxoethyl)cyclohepta-1,4,6-trien-1-yl]-5-(3-methoxyphenyl)pent-2-en-4-ynenitrile;methanamine |
| SMILES | CCNC1=CC(CC=O)=CCC=C1/C(C#N)=C/C#Cc1cccc(OC)c1.CN |
| InChI | InChI=1S/C23H22N2O2.CH5N/c1-3-25-23-16-19(13-14-26)9-6-12-22(23)20(17-24)10-4-7-18-8-5-11-21(15-18)27-2;1-2/h5,8-12,14-16,25H,3,6,13H2,1-2H3;2H2,1H3/b20-10+; |
| InChIKey | DMRQXILSKREOOG-XZISABOOSA-N |
| XLogP | 3.41 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|