About 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide
3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide (PubChem CID 174965315) has the molecular formula C8H9N3O3S
and a molecular weight of 227.25 g/mol. Its IUPAC name is 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide.
Molecular Properties
| Compound Name | 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide |
| PubChem CID | 174965315 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide |
| SMILES | COc1cccc(C#N)c1.O=S1(=O)NN1 |
| InChI | InChI=1S/C8H7NO.H2N2O2S/c1-10-8-4-2-3-7(5-8)6-9;3-5(4)1-2-5/h2-5H,1H3;1-2H |
| InChIKey | LHTHOKDECDMSNM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide?
The IUPAC name of 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide (CID 174965315) is 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide.
What is the SMILES notation for 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide?
The canonical SMILES for 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide is COc1cccc(C#N)c1.O=S1(=O)NN1.
What is the InChIKey of 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide?
The InChIKey is LHTHOKDECDMSNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.H2N2O2S/c1-10-8-4-2-3-7(5-8)6-9;3-5(4)1-2-5/h2-5H,1H3;1-2H.
What are the key properties of 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide?
3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide has a molecular weight of 227.25 g/mol, XLogP of -0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybenzonitrile;thiadiaziridine 1,1-dioxide is sourced from PubChem (CID 174965315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).