C24H30N4O2 — CID 143184904
1-butyl-3-[4-(3-cyano-6-methoxy-1-propylindol-2-yl)phenyl]urea;molecular hydrogen (PubChem CID 143184904) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-butyl-3-[4-(3-cyano-6-methoxy-1-propylindol-2-yl)phenyl]urea;molecular hydrogen.
| Compound Name | 1-butyl-3-[4-(3-cyano-6-methoxy-1-propylindol-2-yl)phenyl]urea;molecular hydrogen |
|---|---|
| PubChem CID | 143184904 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 1-butyl-3-[4-(3-cyano-6-methoxy-1-propylindol-2-yl)phenyl]urea;molecular hydrogen |
| SMILES | CCCCNC(=O)Nc1ccc(-c2c(C#N)c3ccc(OC)cc3n2CCC)cc1.[H][H] |
| InChI | InChI=1S/C24H28N4O2.H2/c1-4-6-13-26-24(29)27-18-9-7-17(8-10-18)23-21(16-25)20-12-11-19(30-3)15-22(20)28(23)14-5-2;/h7-12,15H,4-6,13-14H2,1-3H3,(H2,26,27,29);1H |
| InChIKey | KVVKOYXNXXVZEN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|