C24H28F2N2O2S — CID 143185609
tert-butyl 3-amino-4-(2,3-difluorophenyl)-5-hexylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 143185609) has the molecular formula C24H28F2N2O2S and a molecular weight of 446.56 g/mol. Its IUPAC name is tert-butyl 3-amino-4-(2,3-difluorophenyl)-5-hexylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | tert-butyl 3-amino-4-(2,3-difluorophenyl)-5-hexylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143185609 |
| Molecular Formula | C24H28F2N2O2S |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | tert-butyl 3-amino-4-(2,3-difluorophenyl)-5-hexylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCCCCCc1cnc2sc(C(=O)OC(C)(C)C)c(N)c2c1-c1cccc(F)c1F |
| InChI | InChI=1S/C24H28F2N2O2S/c1-5-6-7-8-10-14-13-28-22-18(17(14)15-11-9-12-16(25)19(15)26)20(27)21(31-22)23(29)30-24(2,3)4/h9,11-13H,5-8,10,27H2,1-4H3 |
| InChIKey | XDYAQWLXWVLUKL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|