C16H24N2O — CID 143186094
3a,4,6-trimethyl-1,2,3,9b-tetrahydropyrrolo[3,4-c]isoquinolin-5-one;ethane (PubChem CID 143186094) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3a,4,6-trimethyl-1,2,3,9b-tetrahydropyrrolo[3,4-c]isoquinolin-5-one;ethane.
| Compound Name | 3a,4,6-trimethyl-1,2,3,9b-tetrahydropyrrolo[3,4-c]isoquinolin-5-one;ethane |
|---|---|
| PubChem CID | 143186094 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3a,4,6-trimethyl-1,2,3,9b-tetrahydropyrrolo[3,4-c]isoquinolin-5-one;ethane |
| SMILES | CC.Cc1cccc2c1C(=O)N(C)C1(C)CNCC21 |
| InChI | InChI=1S/C14H18N2O.C2H6/c1-9-5-4-6-10-11-7-15-8-14(11,2)16(3)13(17)12(9)10;1-2/h4-6,11,15H,7-8H2,1-3H3;1-2H3 |
| InChIKey | SMVJEFHUXZNUMP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |