C41H60N2O3 — CID 143186700
4-butyl-3-(1,3,4,5,7,8-hexahydro-2-benzazepin-2-yl)benzaldehyde;ethyl (E)-3-[4-[1-(methylamino)pentyl]phenyl]prop-2-enoate;propane (PubChem CID 143186700) has the molecular formula C41H60N2O3 and a molecular weight of 628.94 g/mol. Its IUPAC name is 4-butyl-3-(1,3,4,5,7,8-hexahydro-2-benzazepin-2-yl)benzaldehyde;ethyl (E)-3-[4-[1-(methylamino)pentyl]phenyl]prop-2-enoate;propane.
| Compound Name | 4-butyl-3-(1,3,4,5,7,8-hexahydro-2-benzazepin-2-yl)benzaldehyde;ethyl (E)-3-[4-[1-(methylamino)pentyl]phenyl]prop-2-enoate;propane |
|---|---|
| PubChem CID | 143186700 |
| Molecular Formula | C41H60N2O3 |
| Molecular Weight | 628.94 g/mol |
| Exact Mass | 628.46 |
| IUPAC Name | 4-butyl-3-(1,3,4,5,7,8-hexahydro-2-benzazepin-2-yl)benzaldehyde;ethyl (E)-3-[4-[1-(methylamino)pentyl]phenyl]prop-2-enoate;propane |
| SMILES | CCC.CCCCC(NC)c1ccc(/C=C/C(=O)OCC)cc1.CCCCc1ccc(C=O)cc1N1CCCC2=CCCC=C2C1 |
| InChI | InChI=1S/C21H27NO.C17H25NO2.C3H8/c1-2-3-7-19-12-11-17(16-23)14-21(19)22-13-6-10-18-8-4-5-9-20(18)15-22;1-4-6-7-16(18-3)15-11-8-14(9-12-15)10-13-17(19)20-5-2;1-3-2/h8-9,11-12,14,16H,2-7,10,13,15H2,1H3;8-13,16,18H,4-7H2,1-3H3;3H2,1-2H3/b;13-10+; |
| InChIKey | QHCFVEJIMXJLIW-OXEOGTFPSA-N |
| XLogP | 10.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.94 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|