C32H45N3O3 — CID 143186737
(3Z,5Z)-18-cyclooctyl-9-[2-(dimethylamino)ethylcarbamoyl]-7-methyl-11-azatricyclo[9.7.0.012,17]octadeca-1(18),3,5,12(17),13,15-hexaene-14-carboxylic acid (PubChem CID 143186737) has the molecular formula C32H45N3O3 and a molecular weight of 519.73 g/mol. Its IUPAC name is (3Z,5Z)-18-cyclooctyl-9-[2-(dimethylamino)ethylcarbamoyl]-7-methyl-11-azatricyclo[9.7.0.012,17]octadeca-1(18),3,5,12(17),13,15-hexaene-14-carboxylic acid.
| Compound Name | (3Z,5Z)-18-cyclooctyl-9-[2-(dimethylamino)ethylcarbamoyl]-7-methyl-11-azatricyclo[9.7.0.012,17]octadeca-1(18),3,5,12(17),13,15-hexaene-14-carboxylic acid |
|---|---|
| PubChem CID | 143186737 |
| Molecular Formula | C32H45N3O3 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.35 |
| IUPAC Name | (3Z,5Z)-18-cyclooctyl-9-[2-(dimethylamino)ethylcarbamoyl]-7-methyl-11-azatricyclo[9.7.0.012,17]octadeca-1(18),3,5,12(17),13,15-hexaene-14-carboxylic acid |
| SMILES | CC1/C=C\C=C/Cc2c(C3CCCCCCC3)c3ccc(C(=O)O)cc3n2CC(C(=O)NCCN(C)C)C1 |
| InChI | InChI=1S/C32H45N3O3/c1-23-12-8-7-11-15-28-30(24-13-9-5-4-6-10-14-24)27-17-16-25(32(37)38)21-29(27)35(28)22-26(20-23)31(36)33-18-19-34(2)3/h7-8,11-12,16-17,21,23-24,26H,4-6,9-10,13-15,18-20,22H2,1-3H3,(H,33,36)(H,37,38)/b11-7-,12-8- |
| InChIKey | ZWFJPQWIUGFEFL-OXAWKVHCSA-N |
| XLogP | 6.16 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|