About 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one
4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one (PubChem CID 143186993) has the molecular formula C11H12INO
and a molecular weight of 301.13 g/mol. Its IUPAC name is 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one.
Molecular Properties
| Compound Name | 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one |
| PubChem CID | 143186993 |
| Molecular Formula | C11H12INO |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one |
| SMILES | CC1(I)C=CN=C2C(=O)CCCC2=C1 |
| InChI | InChI=1S/C11H12INO/c1-11(12)5-6-13-10-8(7-11)3-2-4-9(10)14/h5-7H,2-4H2,1H3 |
| InChIKey | ICRFKAAZNKCNBX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one?
The IUPAC name of 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one (CID 143186993) is 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one.
What is the SMILES notation for 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one?
The canonical SMILES for 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one is CC1(I)C=CN=C2C(=O)CCCC2=C1.
What is the InChIKey of 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one?
The InChIKey is ICRFKAAZNKCNBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12INO/c1-11(12)5-6-13-10-8(7-11)3-2-4-9(10)14/h5-7H,2-4H2,1H3.
What are the key properties of 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one?
4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one has a molecular weight of 301.13 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-4-methyl-7,8-dihydro-6H-1-benzazepin-9-one is sourced from PubChem (CID 143186993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).