C28H45N5 — CID 143187045
(8R)-N-[[3-[[(3S)-1-butan-2-ylpiperidin-3-yl]methyl]-5-ethenyl-4-ethyl-1,2-dihydroimidazol-2-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 143187045) has the molecular formula C28H45N5 and a molecular weight of 451.70 g/mol. Its IUPAC name is (8R)-N-[[3-[[(3S)-1-butan-2-ylpiperidin-3-yl]methyl]-5-ethenyl-4-ethyl-1,2-dihydroimidazol-2-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8R)-N-[[3-[[(3S)-1-butan-2-ylpiperidin-3-yl]methyl]-5-ethenyl-4-ethyl-1,2-dihydroimidazol-2-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 143187045 |
| Molecular Formula | C28H45N5 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.37 |
| IUPAC Name | (8R)-N-[[3-[[(3S)-1-butan-2-ylpiperidin-3-yl]methyl]-5-ethenyl-4-ethyl-1,2-dihydroimidazol-2-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | C=CC1=C(CC)N(C[C@H]2CCCN(C(C)CC)C2)C(CN(C)[C@@H]2CCCc3cccnc32)N1 |
| InChI | InChI=1S/C28H45N5/c1-6-21(4)32-17-11-12-22(18-32)19-33-25(8-3)24(7-2)30-27(33)20-31(5)26-15-9-13-23-14-10-16-29-28(23)26/h7,10,14,16,21-22,26-27,30H,2,6,8-9,11-13,15,17-20H2,1,3-5H3/t21?,22-,26+,27?/m0/s1 |
| InChIKey | HNCLDJCXPXKDFU-MZAKESMSSA-N |
| XLogP | 4.94 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |