C26H25N5O — CID 143188239
4-[6-[5-(4-methylpiperazin-1-yl)-1H-indol-2-yl]-1H-benzimidazol-2-yl]phenol (PubChem CID 143188239) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-[6-[5-(4-methylpiperazin-1-yl)-1H-indol-2-yl]-1H-benzimidazol-2-yl]phenol.
| Compound Name | 4-[6-[5-(4-methylpiperazin-1-yl)-1H-indol-2-yl]-1H-benzimidazol-2-yl]phenol |
|---|---|
| PubChem CID | 143188239 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-[6-[5-(4-methylpiperazin-1-yl)-1H-indol-2-yl]-1H-benzimidazol-2-yl]phenol |
| SMILES | CN1CCN(c2ccc3[nH]c(-c4ccc5nc(-c6ccc(O)cc6)[nH]c5c4)cc3c2)CC1 |
| InChI | InChI=1S/C26H25N5O/c1-30-10-12-31(13-11-30)20-5-9-22-19(14-20)16-24(27-22)18-4-8-23-25(15-18)29-26(28-23)17-2-6-21(32)7-3-17/h2-9,14-16,27,32H,10-13H2,1H3,(H,28,29) |
| InChIKey | CBKNBQSOTSSRRJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |