C25H30N6O — CID 5288584
6-(4-methylpiperazin-1-yl)-2-[2-[(Z)-prop-1-enyl]-3H-benzimidazol-5-yl]-1H-benzimidazole;prop-2-en-1-ol (PubChem CID 5288584) has the molecular formula C25H30N6O and a molecular weight of 430.56 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-2-[2-[(Z)-prop-1-enyl]-3H-benzimidazol-5-yl]-1H-benzimidazole;prop-2-en-1-ol.
| Compound Name | 6-(4-methylpiperazin-1-yl)-2-[2-[(Z)-prop-1-enyl]-3H-benzimidazol-5-yl]-1H-benzimidazole;prop-2-en-1-ol |
|---|---|
| PubChem CID | 5288584 |
| Molecular Formula | C25H30N6O |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-2-[2-[(Z)-prop-1-enyl]-3H-benzimidazol-5-yl]-1H-benzimidazole;prop-2-en-1-ol |
| SMILES | C/C=C\c1nc2ccc(-c3nc4ccc(N5CCN(C)CC5)cc4[nH]3)cc2[nH]1.C=CCO |
| InChI | InChI=1S/C22H24N6.C3H6O/c1-3-4-21-23-17-7-5-15(13-19(17)24-21)22-25-18-8-6-16(14-20(18)26-22)28-11-9-27(2)10-12-28;1-2-3-4/h3-8,13-14H,9-12H2,1-2H3,(H,23,24)(H,25,26);2,4H,1,3H2/b4-3-; |
| InChIKey | SMHNTIHHAPPQIP-LNKPDPKZSA-N |
| XLogP | 4.06 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|