About 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide
1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide (PubChem CID 143188264) has the molecular formula C15H25IN2O3
and a molecular weight of 408.28 g/mol. Its IUPAC name is 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide.
Molecular Properties
| Compound Name | 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide |
| PubChem CID | 143188264 |
| Molecular Formula | C15H25IN2O3 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)I(N)CO)cc1 |
| InChI | InChI=1S/C15H25IN2O3/c1-2-3-4-5-6-11-21-14-9-7-13(8-10-14)18-15(20)16(17)12-19/h7-10,19H,2-6,11-12,17H2,1H3,(H,18,20) |
| InChIKey | FEAFBNQZWVKLFZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide?
The IUPAC name of 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide (CID 143188264) is 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide.
What is the SMILES notation for 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide?
The canonical SMILES for 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide is CCCCCCCOc1ccc(NC(=O)I(N)CO)cc1.
What is the InChIKey of 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide?
The InChIKey is FEAFBNQZWVKLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25IN2O3/c1-2-3-4-5-6-11-21-14-9-7-13(8-10-14)18-15(20)16(17)12-19/h7-10,19H,2-6,11-12,17H2,1H3,(H,18,20).
What are the key properties of 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide?
1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide has a molecular weight of 408.28 g/mol, XLogP of 3.90, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[amino(hydroxymethyl)-λ3-iodanyl]-N-(4-heptoxyphenyl)formamide is sourced from PubChem (CID 143188264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).