C23H23ClN2O3 — CID 143188428
2-amino-N-[4-[2-[4-(4-chlorophenyl)phenyl]ethoxy]phenyl]-3-hydroxypropanamide (PubChem CID 143188428) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 2-amino-N-[4-[2-[4-(4-chlorophenyl)phenyl]ethoxy]phenyl]-3-hydroxypropanamide.
| Compound Name | 2-amino-N-[4-[2-[4-(4-chlorophenyl)phenyl]ethoxy]phenyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 143188428 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-amino-N-[4-[2-[4-(4-chlorophenyl)phenyl]ethoxy]phenyl]-3-hydroxypropanamide |
| SMILES | NC(CO)C(=O)Nc1ccc(OCCc2ccc(-c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H23ClN2O3/c24-19-7-5-18(6-8-19)17-3-1-16(2-4-17)13-14-29-21-11-9-20(10-12-21)26-23(28)22(25)15-27/h1-12,22,27H,13-15,25H2,(H,26,28) |
| InChIKey | DYJBZLSCAIMWGN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |