C31H43ClN6O2 — CID 143188964
N-[[4-[(7E)-7-[(2E)-2-chloropenta-2,4-dienylidene]-1-methyl-6,8-dihydro-4H-pyrazolo[5,4-e][1,4]diazepine-5-carbonyl]-3-methylphenyl]methyl]-3-piperidin-4-ylpropanamide;ethane (PubChem CID 143188964) has the molecular formula C31H43ClN6O2 and a molecular weight of 567.18 g/mol. Its IUPAC name is N-[[4-[(7E)-7-[(2E)-2-chloropenta-2,4-dienylidene]-1-methyl-6,8-dihydro-4H-pyrazolo[5,4-e][1,4]diazepine-5-carbonyl]-3-methylphenyl]methyl]-3-piperidin-4-ylpropanamide;ethane.
| Compound Name | N-[[4-[(7E)-7-[(2E)-2-chloropenta-2,4-dienylidene]-1-methyl-6,8-dihydro-4H-pyrazolo[5,4-e][1,4]diazepine-5-carbonyl]-3-methylphenyl]methyl]-3-piperidin-4-ylpropanamide;ethane |
|---|---|
| PubChem CID | 143188964 |
| Molecular Formula | C31H43ClN6O2 |
| Molecular Weight | 567.18 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | N-[[4-[(7E)-7-[(2E)-2-chloropenta-2,4-dienylidene]-1-methyl-6,8-dihydro-4H-pyrazolo[5,4-e][1,4]diazepine-5-carbonyl]-3-methylphenyl]methyl]-3-piperidin-4-ylpropanamide;ethane |
| SMILES | C=C/C=C(Cl)\C=C1/CN(C(=O)c2ccc(CNC(=O)CCC3CCNCC3)cc2C)Cc2cnn(C)c2N1.CC |
| InChI | InChI=1S/C29H37ClN6O2.C2H6/c1-4-5-24(30)15-25-19-36(18-23-17-33-35(3)28(23)34-25)29(38)26-8-6-22(14-20(26)2)16-32-27(37)9-7-21-10-12-31-13-11-21;1-2/h4-6,8,14-15,17,21,31,34H,1,7,9-13,16,18-19H2,2-3H3,(H,32,37);1-2H3/b24-5+,25-15+; |
| InChIKey | QQZROCNBVYAEEB-HUTZOPCSSA-N |
| XLogP | 5.41 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.18 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|